C18H27N3O4S — CID 119589146
N-(2-amino-1-cyclohexylethyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide (PubChem CID 119589146) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 119589146 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetamide |
| SMILES | COc1ccc(CSCC(=O)NC(CN)C2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H27N3O4S/c1-25-17-8-7-13(9-16(17)21(23)24)11-26-12-18(22)20-15(10-19)14-5-3-2-4-6-14/h7-9,14-15H,2-6,10-12,19H2,1H3,(H,20,22) |
| InChIKey | ZGDCKEQNZMBVQZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|