C22H26N2O8S — CID 55608063
methyl 3-(3,4-dimethoxyphenyl)-3-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]propanoate (PubChem CID 55608063) has the molecular formula C22H26N2O8S and a molecular weight of 478.52 g/mol. Its IUPAC name is methyl 3-(3,4-dimethoxyphenyl)-3-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]propanoate.
| Compound Name | methyl 3-(3,4-dimethoxyphenyl)-3-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 55608063 |
| Molecular Formula | C22H26N2O8S |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | methyl 3-(3,4-dimethoxyphenyl)-3-[[2-[(4-methoxy-3-nitrophenyl)methylsulfanyl]acetyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CSCc1ccc(OC)c([N+](=O)[O-])c1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O8S/c1-29-18-7-5-14(9-17(18)24(27)28)12-33-13-21(25)23-16(11-22(26)32-4)15-6-8-19(30-2)20(10-15)31-3/h5-10,16H,11-13H2,1-4H3,(H,23,25) |
| InChIKey | GTOKBPBFESMLCK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|