C16H18N4O7 — CID 120684284
3-(3,4-dimethoxyphenyl)-3-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]propanoic acid (PubChem CID 120684284) has the molecular formula C16H18N4O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-3-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-3-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 120684284 |
| Molecular Formula | C16H18N4O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-3-[(1-methyl-4-nitropyrazole-3-carbonyl)amino]propanoic acid |
| SMILES | COc1ccc(C(CC(=O)O)NC(=O)c2nn(C)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H18N4O7/c1-19-8-11(20(24)25)15(18-19)16(23)17-10(7-14(21)22)9-4-5-12(26-2)13(6-9)27-3/h4-6,8,10H,7H2,1-3H3,(H,17,23)(H,21,22) |
| InChIKey | DLWJAHFPVPSFOD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|