C17H28ClN3O4S — CID 119615087
N-(2-amino-1-cyclopropylethyl)-5-(diethylsulfamoyl)-2-methoxybenzamide;hydrochloride (PubChem CID 119615087) has the molecular formula C17H28ClN3O4S and a molecular weight of 405.95 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-5-(diethylsulfamoyl)-2-methoxybenzamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-5-(diethylsulfamoyl)-2-methoxybenzamide;hydrochloride |
|---|---|
| PubChem CID | 119615087 |
| Molecular Formula | C17H28ClN3O4S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-5-(diethylsulfamoyl)-2-methoxybenzamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(C(=O)NC(CN)C2CC2)c1.Cl |
| InChI | InChI=1S/C17H27N3O4S.ClH/c1-4-20(5-2)25(22,23)13-8-9-16(24-3)14(10-13)17(21)19-15(11-18)12-6-7-12;/h8-10,12,15H,4-7,11,18H2,1-3H3,(H,19,21);1H |
| InChIKey | GYKCVIDLYUBSEB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |