C21H26N4O5S — CID 56551198
[5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone (PubChem CID 56551198) has the molecular formula C21H26N4O5S and a molecular weight of 446.53 g/mol. Its IUPAC name is [5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone.
| Compound Name | [5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56551198 |
| Molecular Formula | C21H26N4O5S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | [5-methoxy-2-nitro-4-(1,3-thiazol-4-ylmethoxy)phenyl]-(4-pyrrolidin-1-ylpiperidin-1-yl)methanone |
| SMILES | COc1cc(C(=O)N2CCC(N3CCCC3)CC2)c([N+](=O)[O-])cc1OCc1cscn1 |
| InChI | InChI=1S/C21H26N4O5S/c1-29-19-10-17(18(25(27)28)11-20(19)30-12-15-13-31-14-22-15)21(26)24-8-4-16(5-9-24)23-6-2-3-7-23/h10-11,13-14,16H,2-9,12H2,1H3 |
| InChIKey | CUTXDOWGOBEMRC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|