C24H28FNO4S — CID 43981223
N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]adamantane-1-carboxamide (PubChem CID 43981223) has the molecular formula C24H28FNO4S and a molecular weight of 445.56 g/mol. Its IUPAC name is N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 43981223 |
| Molecular Formula | C24H28FNO4S |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-(furan-2-yl)ethyl]adamantane-1-carboxamide |
| SMILES | Cc1cc(S(=O)(=O)C(CNC(=O)C23CC4CC(CC(C4)C2)C3)c2ccco2)ccc1F |
| InChI | InChI=1S/C24H28FNO4S/c1-15-7-19(4-5-20(15)25)31(28,29)22(21-3-2-6-30-21)14-26-23(27)24-11-16-8-17(12-24)10-18(9-16)13-24/h2-7,16-18,22H,8-14H2,1H3,(H,26,27) |
| InChIKey | ULUXMDHGLIXGMG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |