C18H21NO6S — CID 110315105
N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]oxolane-2-carboxamide (PubChem CID 110315105) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 110315105 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[2-(furan-2-yl)-2-(4-methoxyphenyl)sulfonylethyl]oxolane-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)C(CNC(=O)C2CCCO2)c2ccco2)cc1 |
| InChI | InChI=1S/C18H21NO6S/c1-23-13-6-8-14(9-7-13)26(21,22)17(15-4-2-10-24-15)12-19-18(20)16-5-3-11-25-16/h2,4,6-10,16-17H,3,5,11-12H2,1H3,(H,19,20) |
| InChIKey | TUYBKCSKYPUYEH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |