C19H24N2O4S2 — CID 9167673
N-ethyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide (PubChem CID 9167673) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-ethyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide.
| Compound Name | N-ethyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide |
|---|---|
| PubChem CID | 9167673 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-ethyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide |
| SMILES | CCNC(=O)C(=O)NC[C@H](c1cccs1)S(=O)(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-4-20-18(22)19(23)21-12-17(16-6-5-11-26-16)27(24,25)15-9-7-14(8-10-15)13(2)3/h5-11,13,17H,4,12H2,1-3H3,(H,20,22)(H,21,23)/t17-/m1/s1 |
| InChIKey | VBACGASORHJYSG-QGZVFWFLSA-N |
| XLogP | 2.64 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|