C21H25ClN2O5S — CID 27555026
N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N'-cycloheptyloxamide (PubChem CID 27555026) has the molecular formula C21H25ClN2O5S and a molecular weight of 452.96 g/mol. Its IUPAC name is N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N'-cycloheptyloxamide.
| Compound Name | N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N'-cycloheptyloxamide |
|---|---|
| PubChem CID | 27555026 |
| Molecular Formula | C21H25ClN2O5S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-(furan-2-yl)ethyl]-N'-cycloheptyloxamide |
| SMILES | O=C(NC[C@@H](c1ccco1)S(=O)(=O)c1ccc(Cl)cc1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C21H25ClN2O5S/c22-15-9-11-17(12-10-15)30(27,28)19(18-8-5-13-29-18)14-23-20(25)21(26)24-16-6-3-1-2-4-7-16/h5,8-13,16,19H,1-4,6-7,14H2,(H,23,25)(H,24,26)/t19-/m0/s1 |
| InChIKey | SWSVTHJXQJOZOK-IBGZPJMESA-N |
| XLogP | 3.40 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|