About carboxyiminocarbamic acid;toluene
carboxyiminocarbamic acid;toluene (PubChem CID 69429979) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is carboxyiminocarbamic acid;toluene.
Molecular Properties
| Compound Name | carboxyiminocarbamic acid;toluene |
| PubChem CID | 69429979 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | carboxyiminocarbamic acid;toluene |
| SMILES | Cc1ccccc1.O=C(O)N=NC(=O)O |
| InChI | InChI=1S/C7H8.C2H2N2O4/c1-7-5-3-2-4-6-7;5-1(6)3-4-2(7)8/h2-6H,1H3;(H,5,6)(H,7,8) |
| InChIKey | DXVPACQRMARWRS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze carboxyiminocarbamic acid;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carboxyiminocarbamic acid;toluene?
The IUPAC name of carboxyiminocarbamic acid;toluene (CID 69429979) is carboxyiminocarbamic acid;toluene.
What is the SMILES notation for carboxyiminocarbamic acid;toluene?
The canonical SMILES for carboxyiminocarbamic acid;toluene is Cc1ccccc1.O=C(O)N=NC(=O)O.
What is the InChIKey of carboxyiminocarbamic acid;toluene?
The InChIKey is DXVPACQRMARWRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C2H2N2O4/c1-7-5-3-2-4-6-7;5-1(6)3-4-2(7)8/h2-6H,1H3;(H,5,6)(H,7,8).
What are the key properties of carboxyiminocarbamic acid;toluene?
carboxyiminocarbamic acid;toluene has a molecular weight of 210.19 g/mol, XLogP of 2.79, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carboxyiminocarbamic acid;toluene is sourced from PubChem (CID 69429979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).