C23H20I2N2O5 — CID 126377347
ethyl 2-[2,6-diiodo-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126377347) has the molecular formula C23H20I2N2O5 and a molecular weight of 658.23 g/mol. Its IUPAC name is ethyl 2-[2,6-diiodo-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-diiodo-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126377347 |
| Molecular Formula | C23H20I2N2O5 |
| Molecular Weight | 658.23 g/mol |
| Exact Mass | 657.95 |
| IUPAC Name | ethyl 2-[2,6-diiodo-4-[(Z)-[(3-methoxynaphthalene-2-carbonyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)cc1I |
| InChI | InChI=1S/C23H20I2N2O5/c1-3-31-21(28)13-32-22-18(24)8-14(9-19(22)25)12-26-27-23(29)17-10-15-6-4-5-7-16(15)11-20(17)30-2/h4-12H,3,13H2,1-2H3,(H,27,29)/b26-12- |
| InChIKey | HWHMZJVXHHWHBW-ZRGSRPPYSA-N |
| XLogP | 4.76 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|