C22H16I2N2O3 — CID 126377346
N-[(Z)-(3,5-diiodo-4-prop-2-ynoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide (PubChem CID 126377346) has the molecular formula C22H16I2N2O3 and a molecular weight of 610.19 g/mol. Its IUPAC name is N-[(Z)-(3,5-diiodo-4-prop-2-ynoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[(Z)-(3,5-diiodo-4-prop-2-ynoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 126377346 |
| Molecular Formula | C22H16I2N2O3 |
| Molecular Weight | 610.19 g/mol |
| Exact Mass | 609.93 |
| IUPAC Name | N-[(Z)-(3,5-diiodo-4-prop-2-ynoxyphenyl)methylideneamino]-3-methoxynaphthalene-2-carboxamide |
| SMILES | C#CCOc1c(I)cc(/C=N\NC(=O)c2cc3ccccc3cc2OC)cc1I |
| InChI | InChI=1S/C22H16I2N2O3/c1-3-8-29-21-18(23)9-14(10-19(21)24)13-25-26-22(27)17-11-15-6-4-5-7-16(15)12-20(17)28-2/h1,4-7,9-13H,8H2,2H3,(H,26,27)/b25-13- |
| InChIKey | HULUEZZVVDRWTF-MXAYSNPKSA-N |
| XLogP | 4.83 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.19 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|