C20H11Br3IN3O3 — CID 99659429
[2,4-dibromo-6-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate (PubChem CID 99659429) has the molecular formula C20H11Br3IN3O3 and a molecular weight of 707.94 g/mol. Its IUPAC name is [2,4-dibromo-6-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate.
| Compound Name | [2,4-dibromo-6-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
|---|---|
| PubChem CID | 99659429 |
| Molecular Formula | C20H11Br3IN3O3 |
| Molecular Weight | 707.94 g/mol |
| Exact Mass | 704.74 |
| IUPAC Name | [2,4-dibromo-6-[(Z)-[(5-bromopyridine-3-carbonyl)hydrazinylidene]methyl]phenyl] 2-iodobenzoate |
| SMILES | O=C(N/N=C\c1cc(Br)cc(Br)c1OC(=O)c1ccccc1I)c1cncc(Br)c1 |
| InChI | InChI=1S/C20H11Br3IN3O3/c21-13-5-11(9-26-27-19(28)12-6-14(22)10-25-8-12)18(16(23)7-13)30-20(29)15-3-1-2-4-17(15)24/h1-10H,(H,27,28)/b26-9- |
| InChIKey | OQQCGPUPXMXAIH-WMDMUMDLSA-N |
| XLogP | 5.96 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.94 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|