C27H30ClN3O5S — CID 5113637
4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide (PubChem CID 5113637) has the molecular formula C27H30ClN3O5S and a molecular weight of 544.07 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 5113637 |
| Molecular Formula | C27H30ClN3O5S |
| Molecular Weight | 544.07 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl-methylsulfonylamino]-N-[(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCOc1ccc(C=NNC(=O)c2ccc(N(Cc3ccccc3Cl)S(C)(=O)=O)cc2)cc1OCC |
| InChI | InChI=1S/C27H30ClN3O5S/c1-4-16-36-25-15-10-20(17-26(25)35-5-2)18-29-30-27(32)21-11-13-23(14-12-21)31(37(3,33)34)19-22-8-6-7-9-24(22)28/h6-15,17-18H,4-5,16,19H2,1-3H3,(H,30,32) |
| InChIKey | PHWJSGKSPJZOIZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|