C23H29ClN2O4S — CID 30130647
2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]-N-cycloheptylacetamide (PubChem CID 30130647) has the molecular formula C23H29ClN2O4S and a molecular weight of 465.02 g/mol. Its IUPAC name is 2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]-N-cycloheptylacetamide.
| Compound Name | 2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]-N-cycloheptylacetamide |
|---|---|
| PubChem CID | 30130647 |
| Molecular Formula | C23H29ClN2O4S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]-N-cycloheptylacetamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1Cl)c1ccc(OCC(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C23H29ClN2O4S/c1-31(28,29)26(16-18-8-6-7-11-22(18)24)20-12-14-21(15-13-20)30-17-23(27)25-19-9-4-2-3-5-10-19/h6-8,11-15,19H,2-5,9-10,16-17H2,1H3,(H,25,27) |
| InChIKey | XEUYWZUTFDILBT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |