C24H23ClN2O5S — CID 30130872
N-(3-acetylphenyl)-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide (PubChem CID 30130872) has the molecular formula C24H23ClN2O5S and a molecular weight of 486.98 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide.
| Compound Name | N-(3-acetylphenyl)-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 30130872 |
| Molecular Formula | C24H23ClN2O5S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-(3-acetylphenyl)-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide |
| SMILES | CC(=O)c1cccc(NC(=O)COc2ccc(N(Cc3ccccc3Cl)S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C24H23ClN2O5S/c1-17(28)18-7-5-8-20(14-18)26-24(29)16-32-22-12-10-21(11-13-22)27(33(2,30)31)15-19-6-3-4-9-23(19)25/h3-14H,15-16H2,1-2H3,(H,26,29) |
| InChIKey | QVBXXYAIUBDUGQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |