C30H29ClN2O4S — CID 43888618
N,N-dibenzyl-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide (PubChem CID 43888618) has the molecular formula C30H29ClN2O4S and a molecular weight of 549.09 g/mol. Its IUPAC name is N,N-dibenzyl-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide.
| Compound Name | N,N-dibenzyl-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide |
|---|---|
| PubChem CID | 43888618 |
| Molecular Formula | C30H29ClN2O4S |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | N,N-dibenzyl-2-[4-[(2-chlorophenyl)methyl-methylsulfonylamino]phenoxy]acetamide |
| SMILES | CS(=O)(=O)N(Cc1ccccc1Cl)c1ccc(OCC(=O)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29ClN2O4S/c1-38(35,36)33(22-26-14-8-9-15-29(26)31)27-16-18-28(19-17-27)37-23-30(34)32(20-24-10-4-2-5-11-24)21-25-12-6-3-7-13-25/h2-19H,20-23H2,1H3 |
| InChIKey | HBSIWKYJYYNCJC-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |