C17H17Cl2N3O4S — CID 126034228
2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide (PubChem CID 126034228) has the molecular formula C17H17Cl2N3O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126034228 |
| Molecular Formula | C17H17Cl2N3O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-(4-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)CN(c2cc(Cl)ccc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H17Cl2N3O4S/c1-26-14-6-3-12(4-7-14)10-20-21-17(23)11-22(27(2,24)25)16-9-13(18)5-8-15(16)19/h3-10H,11H2,1-2H3,(H,21,23)/b20-10- |
| InChIKey | HMVBARMAXJPUCM-JMIUGGIZSA-N |
| XLogP | 2.92 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|