C21H25N3O8S — CID 126191607
methyl 2-[4-[(Z)-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126191607) has the molecular formula C21H25N3O8S and a molecular weight of 479.51 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126191607 |
| Molecular Formula | C21H25N3O8S |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | methyl 2-[4-[(Z)-[[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(/C=N\NC(=O)CN(c2cc(OC)ccc2OC)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H25N3O8S/c1-29-17-9-10-19(30-2)18(11-17)24(33(4,27)28)13-20(25)23-22-12-15-5-7-16(8-6-15)32-14-21(26)31-3/h5-12H,13-14H2,1-4H3,(H,23,25)/b22-12- |
| InChIKey | XWBBSJOTUJJNEJ-UUYOSTAYSA-N |
| XLogP | 1.17 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|