C23H20Cl3N3O4S — CID 126031327
N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,5-dichloro-N-methylsulfonylanilino)acetamide (PubChem CID 126031327) has the molecular formula C23H20Cl3N3O4S and a molecular weight of 540.86 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,5-dichloro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,5-dichloro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126031327 |
| Molecular Formula | C23H20Cl3N3O4S |
| Molecular Weight | 540.86 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(2,5-dichloro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc(OCc2cccc(Cl)c2)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C23H20Cl3N3O4S/c1-34(31,32)29(22-12-19(25)7-10-21(22)26)14-23(30)28-27-13-16-5-8-20(9-6-16)33-15-17-3-2-4-18(24)11-17/h2-13H,14-15H2,1H3,(H,28,30)/b27-13- |
| InChIKey | GVFFDDWATMUPAB-WKIKZPBSSA-N |
| XLogP | 5.14 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|