C17H12ClF3N2O3 — CID 170440273
methyl 4-[(E)-[[2-chloro-5-(trifluoromethyl)benzoyl]hydrazinylidene]methyl]benzoate (PubChem CID 170440273) has the molecular formula C17H12ClF3N2O3 and a molecular weight of 384.74 g/mol. Its IUPAC name is methyl 4-[(E)-[[2-chloro-5-(trifluoromethyl)benzoyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(E)-[[2-chloro-5-(trifluoromethyl)benzoyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 170440273 |
| Molecular Formula | C17H12ClF3N2O3 |
| Molecular Weight | 384.74 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | methyl 4-[(E)-[[2-chloro-5-(trifluoromethyl)benzoyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N/NC(=O)c2cc(C(F)(F)F)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H12ClF3N2O3/c1-26-16(25)11-4-2-10(3-5-11)9-22-23-15(24)13-8-12(17(19,20)21)6-7-14(13)18/h2-9H,1H3,(H,23,24)/b22-9+ |
| InChIKey | DVSLCNOFGPPSCW-LSFURLLWSA-N |
| XLogP | 3.91 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|