C21H18N4O6S — CID 51345106
4-[[2-(N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 51345106) has the molecular formula C21H18N4O6S and a molecular weight of 454.46 g/mol. Its IUPAC name is 4-[[2-(N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | 4-[[2-(N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 51345106 |
| Molecular Formula | C21H18N4O6S |
| Molecular Weight | 454.46 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-[[2-(N-(2-nitrophenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18N4O6S/c22-21(27)15-10-12-16(13-11-15)23-20(26)14-24(17-6-2-1-3-7-17)32(30,31)19-9-5-4-8-18(19)25(28)29/h1-13H,14H2,(H2,22,27)(H,23,26) |
| InChIKey | JNUGRHLWFOLECV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|