C14H12FN3O5S — CID 50890619
2-(4-fluoro-N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 50890619) has the molecular formula C14H12FN3O5S and a molecular weight of 353.33 g/mol. Its IUPAC name is 2-(4-fluoro-N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | 2-(4-fluoro-N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 50890619 |
| Molecular Formula | C14H12FN3O5S |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 2-(4-fluoro-N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | NC(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12FN3O5S/c15-10-5-7-11(8-6-10)17(9-14(16)19)24(22,23)13-4-2-1-3-12(13)18(20)21/h1-8H,9H2,(H2,16,19) |
| InChIKey | PVQHSSOQJSSOKX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|