C21H19N3O5S2 — CID 1320235
N-(3-methylsulfanylphenyl)-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 1320235) has the molecular formula C21H19N3O5S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 1320235 |
| Molecular Formula | C21H19N3O5S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | CSc1cccc(NC(=O)CN(c2ccccc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N3O5S2/c1-30-18-11-7-8-16(14-18)22-21(25)15-23(17-9-3-2-4-10-17)31(28,29)20-13-6-5-12-19(20)24(26)27/h2-14H,15H2,1H3,(H,22,25) |
| InChIKey | AEEGQOZJNSNSEE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|