C17H17I2N3O3S — CID 126030461
2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]acetamide (PubChem CID 126030461) has the molecular formula C17H17I2N3O3S and a molecular weight of 597.22 g/mol. Its IUPAC name is 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 126030461 |
| Molecular Formula | C17H17I2N3O3S |
| Molecular Weight | 597.22 g/mol |
| Exact Mass | 596.91 |
| IUPAC Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-1-(3-iodophenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN(c1ccc(I)cc1)S(C)(=O)=O)c1cccc(I)c1 |
| InChI | InChI=1S/C17H17I2N3O3S/c1-12(13-4-3-5-15(19)10-13)20-21-17(23)11-22(26(2,24)25)16-8-6-14(18)7-9-16/h3-10H,11H2,1-2H3,(H,21,23)/b20-12- |
| InChIKey | DVJKGSPIUNDOSF-NDENLUEZSA-N |
| XLogP | 3.20 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|