C17H18IN3O4S — CID 2942786
N-(4-acetamidophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 2942786) has the molecular formula C17H18IN3O4S and a molecular weight of 487.32 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2942786 |
| Molecular Formula | C17H18IN3O4S |
| Molecular Weight | 487.32 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H18IN3O4S/c1-12(22)19-14-5-7-15(8-6-14)20-17(23)11-21(26(2,24)25)16-9-3-13(18)4-10-16/h3-10H,11H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | LZBZKUORTWUTCJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|