C15H13F2IN2O3S — CID 2208111
N-(2,6-difluorophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide (PubChem CID 2208111) has the molecular formula C15H13F2IN2O3S and a molecular weight of 466.25 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 2208111 |
| Molecular Formula | C15H13F2IN2O3S |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 465.97 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(4-iodo-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1c(F)cccc1F)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H13F2IN2O3S/c1-24(22,23)20(11-7-5-10(18)6-8-11)9-14(21)19-15-12(16)3-2-4-13(15)17/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | BRXMKWPMJZQRMR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|