C25H28F2N2O3S — CID 2976519
2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2,6-difluorophenyl)acetamide (PubChem CID 2976519) has the molecular formula C25H28F2N2O3S and a molecular weight of 474.57 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2976519 |
| Molecular Formula | C25H28F2N2O3S |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2,6-difluorophenyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1c(F)cccc1F)c1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H28F2N2O3S/c1-33(31,32)29(15-23(30)28-24-21(26)3-2-4-22(24)27)20-7-5-19(6-8-20)25-12-16-9-17(13-25)11-18(10-16)14-25/h2-8,16-18H,9-15H2,1H3,(H,28,30) |
| InChIKey | GPEHNVLFPXCMIT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |