C28H36N2O3S — CID 133189369
2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-phenylpropyl)acetamide (PubChem CID 133189369) has the molecular formula C28H36N2O3S and a molecular weight of 480.67 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-phenylpropyl)acetamide.
| Compound Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 133189369 |
| Molecular Formula | C28H36N2O3S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-phenylpropyl)acetamide |
| SMILES | CC(CNC(=O)CN(c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)S(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C28H36N2O3S/c1-20(24-6-4-3-5-7-24)18-29-27(31)19-30(34(2,32)33)26-10-8-25(9-11-26)28-15-21-12-22(16-28)14-23(13-21)17-28/h3-11,20-23H,12-19H2,1-2H3,(H,29,31) |
| InChIKey | ZRRFGHHNQBXHMN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |