C27H34N2O4S — CID 2962803
2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-ethoxyphenyl)acetamide (PubChem CID 2962803) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-ethoxyphenyl)acetamide.
| Compound Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2962803 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccccc1NC(=O)CN(c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C27H34N2O4S/c1-3-33-25-7-5-4-6-24(25)28-26(30)18-29(34(2,31)32)23-10-8-22(9-11-23)27-15-19-12-20(16-27)14-21(13-19)17-27/h4-11,19-21H,3,12-18H2,1-2H3,(H,28,30) |
| InChIKey | QJUXXFXDFAMGGA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |