C25H38N2O3S2 — CID 2976607
2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-tert-butylsulfanylethyl)acetamide (PubChem CID 2976607) has the molecular formula C25H38N2O3S2 and a molecular weight of 478.72 g/mol. Its IUPAC name is 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-tert-butylsulfanylethyl)acetamide.
| Compound Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-tert-butylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 2976607 |
| Molecular Formula | C25H38N2O3S2 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[4-(1-adamantyl)-N-methylsulfonylanilino]-N-(2-tert-butylsulfanylethyl)acetamide |
| SMILES | CC(C)(C)SCCNC(=O)CN(c1ccc(C23CC4CC(CC(C4)C2)C3)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H38N2O3S2/c1-24(2,3)31-10-9-26-23(28)17-27(32(4,29)30)22-7-5-21(6-8-22)25-14-18-11-19(15-25)13-20(12-18)16-25/h5-8,18-20H,9-17H2,1-4H3,(H,26,28) |
| InChIKey | MHGOGZWEAISOCU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|