C15H23BrN2O3S2 — CID 2286940
2-(2-bromo-N-methylsulfonylanilino)-N-(2-tert-butylsulfanylethyl)acetamide (PubChem CID 2286940) has the molecular formula C15H23BrN2O3S2 and a molecular weight of 423.40 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-(2-tert-butylsulfanylethyl)acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-(2-tert-butylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 2286940 |
| Molecular Formula | C15H23BrN2O3S2 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-(2-tert-butylsulfanylethyl)acetamide |
| SMILES | CC(C)(C)SCCNC(=O)CN(c1ccccc1Br)S(C)(=O)=O |
| InChI | InChI=1S/C15H23BrN2O3S2/c1-15(2,3)22-10-9-17-14(19)11-18(23(4,20)21)13-8-6-5-7-12(13)16/h5-8H,9-11H2,1-4H3,(H,17,19) |
| InChIKey | NNBUTAGOITVFLQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|