C17H19BrN2O3S — CID 1348545
2-(2-bromo-N-methylsulfonylanilino)-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 1348545) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 1348545 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | Cc1ccc(CNC(=O)CN(c2ccccc2Br)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H19BrN2O3S/c1-13-7-9-14(10-8-13)11-19-17(21)12-20(24(2,22)23)16-6-4-3-5-15(16)18/h3-10H,11-12H2,1-2H3,(H,19,21) |
| InChIKey | QFLROBQSGMYTSY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |