C16H18BrN3O3S2 — CID 2276018
2-(2-bromo-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide (PubChem CID 2276018) has the molecular formula C16H18BrN3O3S2 and a molecular weight of 444.38 g/mol. Its IUPAC name is 2-(2-bromo-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide.
| Compound Name | 2-(2-bromo-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 2276018 |
| Molecular Formula | C16H18BrN3O3S2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 2-(2-bromo-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCSc1ccccn1)c1ccccc1Br |
| InChI | InChI=1S/C16H18BrN3O3S2/c1-25(22,23)20(14-7-3-2-6-13(14)17)12-15(21)18-10-11-24-16-8-4-5-9-19-16/h2-9H,10-12H2,1H3,(H,18,21) |
| InChIKey | NHUABDFXYRQHJS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|