C18H23N3O5S2 — CID 51342792
2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide (PubChem CID 51342792) has the molecular formula C18H23N3O5S2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide.
| Compound Name | 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 51342792 |
| Molecular Formula | C18H23N3O5S2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-(3,4-dimethoxy-N-methylsulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCSc2ccccn2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C18H23N3O5S2/c1-25-15-8-7-14(12-16(15)26-2)21(28(3,23)24)13-17(22)19-10-11-27-18-6-4-5-9-20-18/h4-9,12H,10-11,13H2,1-3H3,(H,19,22) |
| InChIKey | QDKLBMMGABDCDA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|