C20H24Cl2N2O5S2 — CID 5047767
N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide (PubChem CID 5047767) has the molecular formula C20H24Cl2N2O5S2 and a molecular weight of 507.46 g/mol. Its IUPAC name is N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide.
| Compound Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 5047767 |
| Molecular Formula | C20H24Cl2N2O5S2 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | N-[2-[(3,4-dichlorophenyl)methylsulfanyl]ethyl]-2-(3,4-dimethoxy-N-methylsulfonylanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NCCSCc2ccc(Cl)c(Cl)c2)S(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C20H24Cl2N2O5S2/c1-28-18-7-5-15(11-19(18)29-2)24(31(3,26)27)12-20(25)23-8-9-30-13-14-4-6-16(21)17(22)10-14/h4-7,10-11H,8-9,12-13H2,1-3H3,(H,23,25) |
| InChIKey | QFHGHKPCNHFZOC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|