C23H24ClN3O3S2 — CID 51344639
2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide (PubChem CID 51344639) has the molecular formula C23H24ClN3O3S2 and a molecular weight of 490.05 g/mol. Its IUPAC name is 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide.
| Compound Name | 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 51344639 |
| Molecular Formula | C23H24ClN3O3S2 |
| Molecular Weight | 490.05 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-(3-chloro-4-methyl-N-(4-methylphenyl)sulfonylanilino)-N-(2-pyridin-2-ylsulfanylethyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)NCCSc2ccccn2)c2ccc(C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H24ClN3O3S2/c1-17-6-10-20(11-7-17)32(29,30)27(19-9-8-18(2)21(24)15-19)16-22(28)25-13-14-31-23-5-3-4-12-26-23/h3-12,15H,13-14,16H2,1-2H3,(H,25,28) |
| InChIKey | NFPQUWIZPVVPHG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.05 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|