C11H15BrN2O3S — CID 113071538
N-[2-(2-bromo-N-methylsulfonylanilino)ethyl]acetamide (PubChem CID 113071538) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is N-[2-(2-bromo-N-methylsulfonylanilino)ethyl]acetamide.
| Compound Name | N-[2-(2-bromo-N-methylsulfonylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 113071538 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N-[2-(2-bromo-N-methylsulfonylanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCN(c1ccccc1Br)S(C)(=O)=O |
| InChI | InChI=1S/C11H15BrN2O3S/c1-9(15)13-7-8-14(18(2,16)17)11-6-4-3-5-10(11)12/h3-6H,7-8H2,1-2H3,(H,13,15) |
| InChIKey | ZFAQWUAWJQXVMY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |