C11H14Cl2N2O3S — CID 113072046
N-[2-(2,3-dichloro-N-methylsulfonylanilino)ethyl]acetamide (PubChem CID 113072046) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is N-[2-(2,3-dichloro-N-methylsulfonylanilino)ethyl]acetamide.
| Compound Name | N-[2-(2,3-dichloro-N-methylsulfonylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 113072046 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-[2-(2,3-dichloro-N-methylsulfonylanilino)ethyl]acetamide |
| SMILES | CC(=O)NCCN(c1cccc(Cl)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-8(16)14-6-7-15(19(2,17)18)10-5-3-4-9(12)11(10)13/h3-5H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | MWMUNTKQBDRHOP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |