C12H16Cl2N2O4S — CID 46919892
2-(2,3-dichloro-N-methylsulfonylanilino)-N-(2-methoxyethyl)acetamide (PubChem CID 46919892) has the molecular formula C12H16Cl2N2O4S and a molecular weight of 355.24 g/mol. Its IUPAC name is 2-(2,3-dichloro-N-methylsulfonylanilino)-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-(2,3-dichloro-N-methylsulfonylanilino)-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 46919892 |
| Molecular Formula | C12H16Cl2N2O4S |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 2-(2,3-dichloro-N-methylsulfonylanilino)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(c1cccc(Cl)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C12H16Cl2N2O4S/c1-20-7-6-15-11(17)8-16(21(2,18)19)10-5-3-4-9(13)12(10)14/h3-5H,6-8H2,1-2H3,(H,15,17) |
| InChIKey | MJTAFTDKCWZWSQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|