C28H33ClN2O5S — CID 99942808
ethyl 4-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]amino]-3-chlorobenzoate (PubChem CID 99942808) has the molecular formula C28H33ClN2O5S and a molecular weight of 545.10 g/mol. Its IUPAC name is ethyl 4-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]amino]-3-chlorobenzoate.
| Compound Name | ethyl 4-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]amino]-3-chlorobenzoate |
|---|---|
| PubChem CID | 99942808 |
| Molecular Formula | C28H33ClN2O5S |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | ethyl 4-[[2-[4-(1-adamantyl)-N-methylsulfonylanilino]acetyl]amino]-3-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN(c2ccc(C34CC5CC(CC(C5)C3)C4)cc2)S(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C28H33ClN2O5S/c1-3-36-27(33)21-4-9-25(24(29)13-21)30-26(32)17-31(37(2,34)35)23-7-5-22(6-8-23)28-14-18-10-19(15-28)12-20(11-18)16-28/h4-9,13,18-20H,3,10-12,14-17H2,1-2H3,(H,30,32) |
| InChIKey | VTXJGVGLZRWNFM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |