C20H19N5O7S2 — CID 28564287
2-(N-methylsulfonyl-3-nitroanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 28564287) has the molecular formula C20H19N5O7S2 and a molecular weight of 505.53 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-3-nitroanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 28564287 |
| Molecular Formula | C20H19N5O7S2 |
| Molecular Weight | 505.53 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H19N5O7S2/c1-33(29,30)24(16-5-4-6-17(13-16)25(27)28)14-20(26)22-15-8-10-18(11-9-15)34(31,32)23-19-7-2-3-12-21-19/h2-13H,14H2,1H3,(H,21,23)(H,22,26) |
| InChIKey | ZNQZDPMGLBTGHZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|