C23H21Cl3N2O3S2 — CID 51344999
2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 51344999) has the molecular formula C23H21Cl3N2O3S2 and a molecular weight of 543.93 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 51344999 |
| Molecular Formula | C23H21Cl3N2O3S2 |
| Molecular Weight | 543.93 g/mol |
| Exact Mass | 542.01 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3,4-dichloroanilino]-N-[2-[(2-chlorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1)NCCSCc1ccccc1Cl |
| InChI | InChI=1S/C23H21Cl3N2O3S2/c24-20-9-5-4-6-17(20)16-32-13-12-27-23(29)15-28(18-10-11-21(25)22(26)14-18)33(30,31)19-7-2-1-3-8-19/h1-11,14H,12-13,15-16H2,(H,27,29) |
| InChIKey | YQUJRKSMIVYDIE-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|