C12H11ClFN3O3S2 — CID 8844257
N'-(3-chloro-4-fluorophenyl)sulfonyl-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide (PubChem CID 8844257) has the molecular formula C12H11ClFN3O3S2 and a molecular weight of 363.82 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)sulfonyl-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 8844257 |
| Molecular Formula | C12H11ClFN3O3S2 |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-2-(4-methyl-1,3-thiazol-2-yl)acetohydrazide |
| SMILES | Cc1csc(CC(=O)NNS(=O)(=O)c2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H11ClFN3O3S2/c1-7-6-21-12(15-7)5-11(18)16-17-22(19,20)8-2-3-10(14)9(13)4-8/h2-4,6,17H,5H2,1H3,(H,16,18) |
| InChIKey | DZRBLKIUTGHYRT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|