C13H12F3N3O3S2 — CID 8844304
2-(4-methyl-1,3-thiazol-2-yl)-N'-[4-(trifluoromethyl)phenyl]sulfonylacetohydrazide (PubChem CID 8844304) has the molecular formula C13H12F3N3O3S2 and a molecular weight of 379.39 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-N'-[4-(trifluoromethyl)phenyl]sulfonylacetohydrazide.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-N'-[4-(trifluoromethyl)phenyl]sulfonylacetohydrazide |
|---|---|
| PubChem CID | 8844304 |
| Molecular Formula | C13H12F3N3O3S2 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-N'-[4-(trifluoromethyl)phenyl]sulfonylacetohydrazide |
| SMILES | Cc1csc(CC(=O)NNS(=O)(=O)c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C13H12F3N3O3S2/c1-8-7-23-12(17-8)6-11(20)18-19-24(21,22)10-4-2-9(3-5-10)13(14,15)16/h2-5,7,19H,6H2,1H3,(H,18,20) |
| InChIKey | HTJXNYPHPMLZQR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|