C15H11ClFN3O3S3 — CID 2744075
N'-(3-chloro-4-fluorophenyl)sulfonyl-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide (PubChem CID 2744075) has the molecular formula C15H11ClFN3O3S3 and a molecular weight of 431.92 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)sulfonyl-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2744075 |
| Molecular Formula | C15H11ClFN3O3S3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)sulfonyl-4-methyl-2-thiophen-2-yl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(-c2cccs2)sc1C(=O)NNS(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClFN3O3S3/c1-8-13(25-15(18-8)12-3-2-6-24-12)14(21)19-20-26(22,23)9-4-5-11(17)10(16)7-9/h2-7,20H,1H3,(H,19,21) |
| InChIKey | ZQZBBJBKKHBAPU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|