C18H19NO8S — CID 40591803
2-[[(2S)-2-hydroxy-3-(4-methoxycarbonylphenoxy)propyl]sulfamoyl]benzoic acid (PubChem CID 40591803) has the molecular formula C18H19NO8S and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-[[(2S)-2-hydroxy-3-(4-methoxycarbonylphenoxy)propyl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[(2S)-2-hydroxy-3-(4-methoxycarbonylphenoxy)propyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 40591803 |
| Molecular Formula | C18H19NO8S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[[(2S)-2-hydroxy-3-(4-methoxycarbonylphenoxy)propyl]sulfamoyl]benzoic acid |
| SMILES | COC(=O)c1ccc(OC[C@@H](O)CNS(=O)(=O)c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C18H19NO8S/c1-26-18(23)12-6-8-14(9-7-12)27-11-13(20)10-19-28(24,25)16-5-3-2-4-15(16)17(21)22/h2-9,13,19-20H,10-11H2,1H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | ARFMWQHXIYOTED-ZDUSSCGKSA-N |
| XLogP | 0.89 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |