C28H28N2O5S — CID 67589142
(2R)-5-[benzyl(methyl)amino]-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]-5-oxopentanoic acid (PubChem CID 67589142) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is (2R)-5-[benzyl(methyl)amino]-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-[benzyl(methyl)amino]-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67589142 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | (2R)-5-[benzyl(methyl)amino]-2-[[4-[2-(4-methylphenyl)ethynyl]phenyl]sulfonylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(C#Cc2ccc(S(=O)(=O)N[C@H](CCC(=O)N(C)Cc3ccccc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O5S/c1-21-8-10-22(11-9-21)12-13-23-14-16-25(17-15-23)36(34,35)29-26(28(32)33)18-19-27(31)30(2)20-24-6-4-3-5-7-24/h3-11,14-17,26,29H,18-20H2,1-2H3,(H,32,33)/t26-/m1/s1 |
| InChIKey | YSTGTLDBWPHLDU-AREMUKBSSA-N |
| XLogP | 3.57 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|