C26H25BrCl2N2O6S — CID 23288386
2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoic acid (PubChem CID 23288386) has the molecular formula C26H25BrCl2N2O6S and a molecular weight of 644.37 g/mol. Its IUPAC name is 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoic acid.
| Compound Name | 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 23288386 |
| Molecular Formula | C26H25BrCl2N2O6S |
| Molecular Weight | 644.37 g/mol |
| Exact Mass | 642.00 |
| IUPAC Name | 2-[[4-(4-bromophenyl)phenyl]sulfonylamino]-6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoic acid |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)NCCCCC(NS(=O)(=O)c1ccc(-c2ccc(Br)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H25BrCl2N2O6S/c27-19-8-4-17(5-9-19)18-6-11-21(12-7-18)38(35,36)31-23(26(33)34)3-1-2-14-30-25(32)16-37-24-13-10-20(28)15-22(24)29/h4-13,15,23,31H,1-3,14,16H2,(H,30,32)(H,33,34) |
| InChIKey | VEEKBYDZLWFBLA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|