C19H21BrCl2N2O3S — CID 42703141
2-[(4-bromophenyl)sulfonylamino]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide (PubChem CID 42703141) has the molecular formula C19H21BrCl2N2O3S and a molecular weight of 508.27 g/mol. Its IUPAC name is 2-[(4-bromophenyl)sulfonylamino]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide.
| Compound Name | 2-[(4-bromophenyl)sulfonylamino]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 42703141 |
| Molecular Formula | C19H21BrCl2N2O3S |
| Molecular Weight | 508.27 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | 2-[(4-bromophenyl)sulfonylamino]-N-[2-(2,4-dichlorophenyl)ethyl]pentanamide |
| SMILES | CCCC(NS(=O)(=O)c1ccc(Br)cc1)C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H21BrCl2N2O3S/c1-2-3-18(24-28(26,27)16-8-5-14(20)6-9-16)19(25)23-11-10-13-4-7-15(21)12-17(13)22/h4-9,12,18,24H,2-3,10-11H2,1H3,(H,23,25) |
| InChIKey | ITCIOOJFVPARLJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.27 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |